C27H30N2O3 — CID 91512257
(8S)-8-benzyl-N-(4-cyclohexylphenyl)-1,3-dioxo-6,7-dihydro-5H-pyrrolizine-2-carboxamide (PubChem CID 91512257) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (8S)-8-benzyl-N-(4-cyclohexylphenyl)-1,3-dioxo-6,7-dihydro-5H-pyrrolizine-2-carboxamide.
| Compound Name | (8S)-8-benzyl-N-(4-cyclohexylphenyl)-1,3-dioxo-6,7-dihydro-5H-pyrrolizine-2-carboxamide |
|---|---|
| PubChem CID | 91512257 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (8S)-8-benzyl-N-(4-cyclohexylphenyl)-1,3-dioxo-6,7-dihydro-5H-pyrrolizine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)C1C(=O)N2CCC[C@]2(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H30N2O3/c30-24-23(25(31)28-22-14-12-21(13-15-22)20-10-5-2-6-11-20)26(32)29-17-7-16-27(24,29)18-19-8-3-1-4-9-19/h1,3-4,8-9,12-15,20,23H,2,5-7,10-11,16-18H2,(H,28,31)/t23?,27-/m0/s1 |
| InChIKey | JEMSCRDABNAYPH-JVHFYALYSA-N |
| XLogP | 4.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|