About 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane
1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane (PubChem CID 91512282) has the molecular formula C12H18N+
and a molecular weight of 178.29 g/mol. Its IUPAC name is 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane.
Molecular Properties
| Compound Name | 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane |
| PubChem CID | 91512282 |
| Molecular Formula | C12H18N+ |
| Molecular Weight | 178.29 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane |
| SMILES | CC[N+]1=C(C)Cc2ccccc21.[3H]C |
| InChI | InChI=1S/C11H14N.CH4/c1-3-12-9(2)8-10-6-4-5-7-11(10)12;/h4-7H,3,8H2,1-2H3;1H4/q+1;/i;1T |
| InChIKey | CWLKMPAOERONAL-WMTCLNHOSA-N |
| XLogP | 3.00 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane?
The IUPAC name of 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane (CID 91512282) is 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane.
What is the SMILES notation for 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane?
The canonical SMILES for 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane is CC[N+]1=C(C)Cc2ccccc21.[3H]C.
What is the InChIKey of 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane?
The InChIKey is CWLKMPAOERONAL-WMTCLNHOSA-N. The full InChI is InChI=1S/C11H14N.CH4/c1-3-12-9(2)8-10-6-4-5-7-11(10)12;/h4-7H,3,8H2,1-2H3;1H4/q+1;/i;1T.
What are the key properties of 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane?
1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane has a molecular weight of 178.29 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methyl-3H-indol-1-ium;tritiomethane is sourced from PubChem (CID 91512282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).