C15H16N2O5S — CID 91512322
(2S)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylamino]propanamide (PubChem CID 91512322) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is (2S)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 91512322 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2S)-N,3-dihydroxy-2-[(4-phenylphenyl)sulfonylamino]propanamide |
| SMILES | O=C(NO)[C@H](CO)NS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N2O5S/c18-10-14(15(19)16-20)17-23(21,22)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14,17-18,20H,10H2,(H,16,19)/t14-/m0/s1 |
| InChIKey | LLRBPJHBGWTREP-AWEZNQCLSA-N |
| XLogP | 0.50 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|