C21H23BrFN3O3 — CID 91512331
(1R,2R,3R,4S)-2-(3-amino-3-oxopropyl)-3-[(4-bromo-2-fluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 91512331) has the molecular formula C21H23BrFN3O3 and a molecular weight of 464.34 g/mol. Its IUPAC name is (1R,2R,3R,4S)-2-(3-amino-3-oxopropyl)-3-[(4-bromo-2-fluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-2-(3-amino-3-oxopropyl)-3-[(4-bromo-2-fluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 91512331 |
| Molecular Formula | C21H23BrFN3O3 |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (1R,2R,3R,4S)-2-(3-amino-3-oxopropyl)-3-[(4-bromo-2-fluorophenyl)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | NC(=O)CC[C@@]1(C(N)=O)[C@@H]2C=C[C@@H](C23CC3)[C@@]1(Cc1ccc(Br)cc1F)C(N)=O |
| InChI | InChI=1S/C21H23BrFN3O3/c22-12-2-1-11(13(23)9-12)10-21(18(26)29)15-4-3-14(19(15)7-8-19)20(21,17(25)28)6-5-16(24)27/h1-4,9,14-15H,5-8,10H2,(H2,24,27)(H2,25,28)(H2,26,29)/t14-,15+,20+,21+/m1/s1 |
| InChIKey | GRJUBTSWUWFJSG-UFNANVBGSA-N |
| XLogP | 1.94 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|