C52H92O10 — CID 91512579
4-[2,3-bis[2-(propoxymethyl)penta-3,4-dienoxy]propoxymethyl]-5-propoxypenta-1,2-diene;5-(propoxymethyl)-6-[2-[2-(propoxymethyl)hex-5-enoxy]ethoxy]hex-1-ene (PubChem CID 91512579) has the molecular formula C52H92O10 and a molecular weight of 877.30 g/mol. Its IUPAC name is 4-[2,3-bis[2-(propoxymethyl)penta-3,4-dienoxy]propoxymethyl]-5-propoxypenta-1,2-diene;5-(propoxymethyl)-6-[2-[2-(propoxymethyl)hex-5-enoxy]ethoxy]hex-1-ene.
| Compound Name | 4-[2,3-bis[2-(propoxymethyl)penta-3,4-dienoxy]propoxymethyl]-5-propoxypenta-1,2-diene;5-(propoxymethyl)-6-[2-[2-(propoxymethyl)hex-5-enoxy]ethoxy]hex-1-ene |
|---|---|
| PubChem CID | 91512579 |
| Molecular Formula | C52H92O10 |
| Molecular Weight | 877.30 g/mol |
| Exact Mass | 876.67 |
| IUPAC Name | 4-[2,3-bis[2-(propoxymethyl)penta-3,4-dienoxy]propoxymethyl]-5-propoxypenta-1,2-diene;5-(propoxymethyl)-6-[2-[2-(propoxymethyl)hex-5-enoxy]ethoxy]hex-1-ene |
| SMILES | C=C=CC(COCCC)COCC(COCC(C=C=C)COCCC)OCC(C=C=C)COCCC.C=CCCC(COCCC)COCCOCC(CCC=C)COCCC |
| InChI | InChI=1S/C30H50O6.C22H42O4/c1-7-13-27(19-31-16-10-4)22-34-25-30(36-24-29(15-9-3)21-33-18-12-6)26-35-23-28(14-8-2)20-32-17-11-5;1-5-9-11-21(17-23-13-7-3)19-25-15-16-26-20-22(12-10-6-2)18-24-14-8-4/h13-15,27-30H,1-3,10-12,16-26H2,4-6H3;5-6,21-22H,1-2,7-20H2,3-4H3 |
| InChIKey | MQDAOMFRBCXWDC-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.30 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|