About CID 91513082
CID 91513082 (PubChem CID 91513082) has the molecular formula C8H8BN2O
and a molecular weight of 158.98 g/mol.
Molecular Properties
| Compound Name | CID 91513082 |
| PubChem CID | 91513082 |
| Molecular Formula | C8H8BN2O |
| Molecular Weight | 158.98 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | — |
| SMILES | Cc1nn(C)c(=O)c2c1[B]C=C2 |
| InChI | InChI=1S/C8H8BN2O/c1-5-7-6(3-4-9-7)8(12)11(2)10-5/h3-4H,1-2H3 |
| InChIKey | NBUFYVCXKGIWCX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.98 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91513082 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91513082?
The IUPAC name of CID 91513082 (CID 91513082) is not available.
What is the SMILES notation for CID 91513082?
The canonical SMILES for CID 91513082 is Cc1nn(C)c(=O)c2c1[B]C=C2.
What is the InChIKey of CID 91513082?
The InChIKey is NBUFYVCXKGIWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BN2O/c1-5-7-6(3-4-9-7)8(12)11(2)10-5/h3-4H,1-2H3.
What are the key properties of CID 91513082?
CID 91513082 has a molecular weight of 158.98 g/mol, XLogP of -0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91513082 is sourced from PubChem (CID 91513082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).