C7H12N2 — CID 91513752
4,7-dimethyl-4,5-dihydro-1H-1,3-diazepine (PubChem CID 91513752) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 4,7-dimethyl-4,5-dihydro-1H-1,3-diazepine.
| Compound Name | 4,7-dimethyl-4,5-dihydro-1H-1,3-diazepine |
|---|---|
| PubChem CID | 91513752 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 4,7-dimethyl-4,5-dihydro-1H-1,3-diazepine |
| SMILES | CC1=CCC(C)N=CN1 |
| InChI | InChI=1S/C7H12N2/c1-6-3-4-7(2)9-5-8-6/h3,5,7H,4H2,1-2H3,(H,8,9) |
| InChIKey | PVUWVAVRBZZPJD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |