C12H14N4O3S — CID 91514082
N'-hydroxy-2-[(6-propan-2-yloxy-3-pyridinyl)oxy]-1,3-thiazole-5-carboximidamide (PubChem CID 91514082) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is N'-hydroxy-2-[(6-propan-2-yloxy-3-pyridinyl)oxy]-1,3-thiazole-5-carboximidamide.
| Compound Name | N'-hydroxy-2-[(6-propan-2-yloxy-3-pyridinyl)oxy]-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 91514082 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N'-hydroxy-2-[(6-propan-2-yloxy-3-pyridinyl)oxy]-1,3-thiazole-5-carboximidamide |
| SMILES | CC(C)Oc1ccc(Oc2ncc(C(N)=NO)s2)cn1 |
| InChI | InChI=1S/C12H14N4O3S/c1-7(2)18-10-4-3-8(5-14-10)19-12-15-6-9(20-12)11(13)16-17/h3-7,17H,1-2H3,(H2,13,16) |
| InChIKey | SISPUTBFNOLVEI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|