About 5,6,7-trifluoroquinazoline
5,6,7-trifluoroquinazoline (PubChem CID 91514521) has the molecular formula C8H3F3N2
and a molecular weight of 184.12 g/mol. Its IUPAC name is 5,6,7-trifluoroquinazoline.
Molecular Properties
| Compound Name | 5,6,7-trifluoroquinazoline |
| PubChem CID | 91514521 |
| Molecular Formula | C8H3F3N2 |
| Molecular Weight | 184.12 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 5,6,7-trifluoroquinazoline |
| SMILES | Fc1cc2ncncc2c(F)c1F |
| InChI | InChI=1S/C8H3F3N2/c9-5-1-6-4(2-12-3-13-6)7(10)8(5)11/h1-3H |
| InChIKey | KOMPVQHSIVGXTM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.12 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5,6,7-trifluoroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7-trifluoroquinazoline?
The IUPAC name of 5,6,7-trifluoroquinazoline (CID 91514521) is 5,6,7-trifluoroquinazoline.
What is the SMILES notation for 5,6,7-trifluoroquinazoline?
The canonical SMILES for 5,6,7-trifluoroquinazoline is Fc1cc2ncncc2c(F)c1F.
What is the InChIKey of 5,6,7-trifluoroquinazoline?
The InChIKey is KOMPVQHSIVGXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F3N2/c9-5-1-6-4(2-12-3-13-6)7(10)8(5)11/h1-3H.
What are the key properties of 5,6,7-trifluoroquinazoline?
5,6,7-trifluoroquinazoline has a molecular weight of 184.12 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7-trifluoroquinazoline is sourced from PubChem (CID 91514521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).