About 10H-phenothiazin-1-yl propane-1-sulfonate
10H-phenothiazin-1-yl propane-1-sulfonate (PubChem CID 91514583) has the molecular formula C15H15NO3S2
and a molecular weight of 321.42 g/mol. Its IUPAC name is 10H-phenothiazin-1-yl propane-1-sulfonate.
Molecular Properties
| Compound Name | 10H-phenothiazin-1-yl propane-1-sulfonate |
| PubChem CID | 91514583 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 10H-phenothiazin-1-yl propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1cccc2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C15H15NO3S2/c1-2-10-21(17,18)19-12-7-5-9-14-15(12)16-11-6-3-4-8-13(11)20-14/h3-9,16H,2,10H2,1H3 |
| InChIKey | KZJAPWBXQUHTJM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenothiazin-1-yl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenothiazin-1-yl propane-1-sulfonate?
The IUPAC name of 10H-phenothiazin-1-yl propane-1-sulfonate (CID 91514583) is 10H-phenothiazin-1-yl propane-1-sulfonate.
What is the SMILES notation for 10H-phenothiazin-1-yl propane-1-sulfonate?
The canonical SMILES for 10H-phenothiazin-1-yl propane-1-sulfonate is CCCS(=O)(=O)Oc1cccc2c1Nc1ccccc1S2.
What is the InChIKey of 10H-phenothiazin-1-yl propane-1-sulfonate?
The InChIKey is KZJAPWBXQUHTJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3S2/c1-2-10-21(17,18)19-12-7-5-9-14-15(12)16-11-6-3-4-8-13(11)20-14/h3-9,16H,2,10H2,1H3.
What are the key properties of 10H-phenothiazin-1-yl propane-1-sulfonate?
10H-phenothiazin-1-yl propane-1-sulfonate has a molecular weight of 321.42 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenothiazin-1-yl propane-1-sulfonate is sourced from PubChem (CID 91514583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).