C29H26BrN5O3 — CID 91514641
(15S)-N-[5-[2-(4-bromophenyl)propan-2-yl]-1H-1,2,4-triazol-3-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 91514641) has the molecular formula C29H26BrN5O3 and a molecular weight of 572.46 g/mol. Its IUPAC name is (15S)-N-[5-[2-(4-bromophenyl)propan-2-yl]-1H-1,2,4-triazol-3-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | (15S)-N-[5-[2-(4-bromophenyl)propan-2-yl]-1H-1,2,4-triazol-3-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 91514641 |
| Molecular Formula | C29H26BrN5O3 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | (15S)-N-[5-[2-(4-bromophenyl)propan-2-yl]-1H-1,2,4-triazol-3-yl]-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC(C)(c1ccc(Br)cc1)c1nc(NC(=O)[C@@]2(C)CC3([N+](=O)[O-])c4ccccc4C2c2ccccc23)n[nH]1 |
| InChI | InChI=1S/C29H26BrN5O3/c1-27(2,17-12-14-18(30)15-13-17)24-31-26(34-33-24)32-25(36)28(3)16-29(35(37)38)21-10-6-4-8-19(21)23(28)20-9-5-7-11-22(20)29/h4-15,23H,16H2,1-3H3,(H2,31,32,33,34,36)/t23?,28-,29?/m0/s1 |
| InChIKey | KRIOWUSHIZTZHO-NWPFNTSYSA-N |
| XLogP | 5.91 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|