C18H19FN2O3S — CID 91514693
N-(4-tert-butyl-2-fluoro-5-hydroxyphenyl)-7-oxo-6,7a-dihydro-3aH-thieno[3,2-b]pyridine-6-carboxamide (PubChem CID 91514693) has the molecular formula C18H19FN2O3S and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(4-tert-butyl-2-fluoro-5-hydroxyphenyl)-7-oxo-6,7a-dihydro-3aH-thieno[3,2-b]pyridine-6-carboxamide.
| Compound Name | N-(4-tert-butyl-2-fluoro-5-hydroxyphenyl)-7-oxo-6,7a-dihydro-3aH-thieno[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 91514693 |
| Molecular Formula | C18H19FN2O3S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-(4-tert-butyl-2-fluoro-5-hydroxyphenyl)-7-oxo-6,7a-dihydro-3aH-thieno[3,2-b]pyridine-6-carboxamide |
| SMILES | CC(C)(C)c1cc(F)c(NC(=O)C2C=NC3C=CSC3C2=O)cc1O |
| InChI | InChI=1S/C18H19FN2O3S/c1-18(2,3)10-6-11(19)13(7-14(10)22)21-17(24)9-8-20-12-4-5-25-16(12)15(9)23/h4-9,12,16,22H,1-3H3,(H,21,24) |
| InChIKey | KHOPLMGLSQKYBB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|