C18H18F2N2O — CID 9151566
(3,5-difluorophenyl)-[4-(2-methylphenyl)piperazin-1-yl]methanone (PubChem CID 9151566) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is (3,5-difluorophenyl)-[4-(2-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-difluorophenyl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9151566 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3,5-difluorophenyl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccccc1N1CCN(C(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C18H18F2N2O/c1-13-4-2-3-5-17(13)21-6-8-22(9-7-21)18(23)14-10-15(19)12-16(20)11-14/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | JYUFGLUOHMWPBU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |