About 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane
4,5-dimethyl-3,6-dihydro-2H-pyran;ethane (PubChem CID 91515777) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane.
Molecular Properties
| Compound Name | 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane |
| PubChem CID | 91515777 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane |
| SMILES | CC.CC1=C(C)COCC1 |
| InChI | InChI=1S/C7H12O.C2H6/c1-6-3-4-8-5-7(6)2;1-2/h3-5H2,1-2H3;1-2H3 |
| InChIKey | DYGMPCRSESLJPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane?
The IUPAC name of 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane (CID 91515777) is 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane.
What is the SMILES notation for 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane?
The canonical SMILES for 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane is CC.CC1=C(C)COCC1.
What is the InChIKey of 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane?
The InChIKey is DYGMPCRSESLJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C2H6/c1-6-3-4-8-5-7(6)2;1-2/h3-5H2,1-2H3;1-2H3.
What are the key properties of 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane?
4,5-dimethyl-3,6-dihydro-2H-pyran;ethane has a molecular weight of 142.24 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3,6-dihydro-2H-pyran;ethane is sourced from PubChem (CID 91515777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).