About 2,3-dihydro-1,5-benzodiazepin-4-one
2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 91516001) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 2,3-dihydro-1,5-benzodiazepin-4-one.
Molecular Properties
| Compound Name | 2,3-dihydro-1,5-benzodiazepin-4-one |
| PubChem CID | 91516001 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | O=C1CCN=c2ccccc2=N1 |
| InChI | InChI=1S/C9H8N2O/c12-9-5-6-10-7-3-1-2-4-8(7)11-9/h1-4H,5-6H2 |
| InChIKey | BFIUJUVNNFZDSN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1,5-benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,5-benzodiazepin-4-one?
The IUPAC name of 2,3-dihydro-1,5-benzodiazepin-4-one (CID 91516001) is 2,3-dihydro-1,5-benzodiazepin-4-one.
What is the SMILES notation for 2,3-dihydro-1,5-benzodiazepin-4-one?
The canonical SMILES for 2,3-dihydro-1,5-benzodiazepin-4-one is O=C1CCN=c2ccccc2=N1.
What is the InChIKey of 2,3-dihydro-1,5-benzodiazepin-4-one?
The InChIKey is BFIUJUVNNFZDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-9-5-6-10-7-3-1-2-4-8(7)11-9/h1-4H,5-6H2.
What are the key properties of 2,3-dihydro-1,5-benzodiazepin-4-one?
2,3-dihydro-1,5-benzodiazepin-4-one has a molecular weight of 160.18 g/mol, XLogP of -0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,5-benzodiazepin-4-one is sourced from PubChem (CID 91516001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).