C37H44N2O7 — CID 91516020
N-[[(6aR,10aS,11aS)-8-acetyl-3-tert-butyl-4,6a-dihydroxy-9,10a,11a-trimethyl-5,6,7-trioxo-10-propan-2-yl-5a,8,11,12-tetrahydrotetracen-1-yl]methyl]pyridine-3-carboxamide (PubChem CID 91516020) has the molecular formula C37H44N2O7 and a molecular weight of 628.77 g/mol. Its IUPAC name is N-[[(6aR,10aS,11aS)-8-acetyl-3-tert-butyl-4,6a-dihydroxy-9,10a,11a-trimethyl-5,6,7-trioxo-10-propan-2-yl-5a,8,11,12-tetrahydrotetracen-1-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[(6aR,10aS,11aS)-8-acetyl-3-tert-butyl-4,6a-dihydroxy-9,10a,11a-trimethyl-5,6,7-trioxo-10-propan-2-yl-5a,8,11,12-tetrahydrotetracen-1-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91516020 |
| Molecular Formula | C37H44N2O7 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | N-[[(6aR,10aS,11aS)-8-acetyl-3-tert-butyl-4,6a-dihydroxy-9,10a,11a-trimethyl-5,6,7-trioxo-10-propan-2-yl-5a,8,11,12-tetrahydrotetracen-1-yl]methyl]pyridine-3-carboxamide |
| SMILES | CC(=O)C1C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(C(C)(C)C)cc(CNC(=O)c5cccnc5)c4C[C@@]3(C)C[C@@]2(C)C(C(C)C)=C1C |
| InChI | InChI=1S/C37H44N2O7/c1-18(2)27-19(3)25(20(4)40)31(43)37(46)32(44)28-30(42)26-23(14-35(28,8)17-36(27,37)9)22(13-24(29(26)41)34(5,6)7)16-39-33(45)21-11-10-12-38-15-21/h10-13,15,18,25,28,41,46H,14,16-17H2,1-9H3,(H,39,45)/t25?,28?,35-,36-,37+/m0/s1 |
| InChIKey | XBNRMSDXHJJMCI-GNIGPBQZSA-N |
| XLogP | 4.85 |
| TPSA | 150.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|