About 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene
8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene (PubChem CID 91516444) has the molecular formula C9H8FNO2
and a molecular weight of 181.17 g/mol. Its IUPAC name is 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene |
| PubChem CID | 91516444 |
| Molecular Formula | C9H8FNO2 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene |
| SMILES | O=NC1COCc2c(F)cccc21 |
| InChI | InChI=1S/C9H8FNO2/c10-8-3-1-2-6-7(8)4-13-5-9(6)11-12/h1-3,9H,4-5H2 |
| InChIKey | RJYREZJQCVAKGK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene?
The IUPAC name of 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene (CID 91516444) is 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene?
The canonical SMILES for 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene is O=NC1COCc2c(F)cccc21.
What is the InChIKey of 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene?
The InChIKey is RJYREZJQCVAKGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2/c10-8-3-1-2-6-7(8)4-13-5-9(6)11-12/h1-3,9H,4-5H2.
What are the key properties of 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene?
8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene has a molecular weight of 181.17 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-nitroso-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 91516444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).