C22H25N5O2 — CID 91516459
[(Z)-1-[2-methoxy-7,8-dimethyl-5-(2-methylphenyl)-3H-1,4-benzodiazepin-3-yl]ethylideneamino]urea (PubChem CID 91516459) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is [(Z)-1-[2-methoxy-7,8-dimethyl-5-(2-methylphenyl)-3H-1,4-benzodiazepin-3-yl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[2-methoxy-7,8-dimethyl-5-(2-methylphenyl)-3H-1,4-benzodiazepin-3-yl]ethylideneamino]urea |
|---|---|
| PubChem CID | 91516459 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [(Z)-1-[2-methoxy-7,8-dimethyl-5-(2-methylphenyl)-3H-1,4-benzodiazepin-3-yl]ethylideneamino]urea |
| SMILES | COC1=Nc2cc(C)c(C)cc2C(c2ccccc2C)=NC1/C(C)=N\NC(N)=O |
| InChI | InChI=1S/C22H25N5O2/c1-12-8-6-7-9-16(12)20-17-10-13(2)14(3)11-18(17)24-21(29-5)19(25-20)15(4)26-27-22(23)28/h6-11,19H,1-5H3,(H3,23,27,28)/b26-15- |
| InChIKey | IQGKIBMFASBUQG-YSMPRRRNSA-N |
| XLogP | 3.55 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|