C13H27NO — CID 91516800
ethane;(5E)-6-methoxy-1,3-dimethyl-2,3,4,7,8,9-hexahydroazonine (PubChem CID 91516800) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is ethane;(5E)-6-methoxy-1,3-dimethyl-2,3,4,7,8,9-hexahydroazonine.
| Compound Name | ethane;(5E)-6-methoxy-1,3-dimethyl-2,3,4,7,8,9-hexahydroazonine |
|---|---|
| PubChem CID | 91516800 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | ethane;(5E)-6-methoxy-1,3-dimethyl-2,3,4,7,8,9-hexahydroazonine |
| SMILES | CC.CO/C1=C/CC(C)CN(C)CCC1 |
| InChI | InChI=1S/C11H21NO.C2H6/c1-10-6-7-11(13-3)5-4-8-12(2)9-10;1-2/h7,10H,4-6,8-9H2,1-3H3;1-2H3/b11-7+; |
| InChIKey | XCUHPKAMVWSNBK-RVDQCCQOSA-N |
| XLogP | 3.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |