C23H25ClN4O3S — CID 91517150
[8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate (PubChem CID 91517150) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is [8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate.
| Compound Name | [8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 91517150 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [8-[(4-methylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate |
| SMILES | Cc1ccc(NC(=S)N2CCC3(C=C(OC(=O)NCc4ccc(Cl)cc4)NO3)CC2)cc1 |
| InChI | InChI=1S/C23H25ClN4O3S/c1-16-2-8-19(9-3-16)26-21(32)28-12-10-23(11-13-28)14-20(27-31-23)30-22(29)25-15-17-4-6-18(24)7-5-17/h2-9,14,27H,10-13,15H2,1H3,(H,25,29)(H,26,32) |
| InChIKey | LXKPZECGBOXOAN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|