C8H2O2S4 — CID 91517545
1,3,4,6-tetrakis(sulfanylidene)-3a,6a-dihydropentalene-2,5-dione (PubChem CID 91517545) has the molecular formula C8H2O2S4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 1,3,4,6-tetrakis(sulfanylidene)-3a,6a-dihydropentalene-2,5-dione.
| Compound Name | 1,3,4,6-tetrakis(sulfanylidene)-3a,6a-dihydropentalene-2,5-dione |
|---|---|
| PubChem CID | 91517545 |
| Molecular Formula | C8H2O2S4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 257.89 |
| IUPAC Name | 1,3,4,6-tetrakis(sulfanylidene)-3a,6a-dihydropentalene-2,5-dione |
| SMILES | O=C1C(=S)C2C(=S)C(=O)C(=S)C2C1=S |
| InChI | InChI=1S/C8H2O2S4/c9-3-5(11)1-2(7(3)13)8(14)4(10)6(1)12/h1-2H |
| InChIKey | GJBSSXRMVAJOCB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|