About 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine
6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine (PubChem CID 91517572) has the molecular formula C22H24BrN3O
and a molecular weight of 426.36 g/mol. Its IUPAC name is 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine |
| PubChem CID | 91517572 |
| Molecular Formula | C22H24BrN3O |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine |
| SMILES | CC1(C)CCC(Oc2cc(Br)cc3cnc(Nc4ccccc4)nc23)CC1 |
| InChI | InChI=1S/C22H24BrN3O/c1-22(2)10-8-18(9-11-22)27-19-13-16(23)12-15-14-24-21(26-20(15)19)25-17-6-4-3-5-7-17/h3-7,12-14,18H,8-11H2,1-2H3,(H,24,25,26) |
| InChIKey | ZNBBXGAZLBYNLV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine?
The IUPAC name of 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine (CID 91517572) is 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine.
What is the SMILES notation for 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine?
The canonical SMILES for 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine is CC1(C)CCC(Oc2cc(Br)cc3cnc(Nc4ccccc4)nc23)CC1.
What is the InChIKey of 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine?
The InChIKey is ZNBBXGAZLBYNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24BrN3O/c1-22(2)10-8-18(9-11-22)27-19-13-16(23)12-15-14-24-21(26-20(15)19)25-17-6-4-3-5-7-17/h3-7,12-14,18H,8-11H2,1-2H3,(H,24,25,26).
What are the key properties of 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine?
6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine has a molecular weight of 426.36 g/mol, XLogP of 6.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-(4,4-dimethylcyclohexyl)oxy-N-phenylquinazolin-2-amine is sourced from PubChem (CID 91517572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).