About (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate
(1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate (PubChem CID 91517821) has the molecular formula C17H18N2O5
and a molecular weight of 330.34 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate |
| PubChem CID | 91517821 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate |
| SMILES | NC(=O)C1(OC(=O)c2c(O)c3ccccc3[nH]c2=O)CCCCC1 |
| InChI | InChI=1S/C17H18N2O5/c18-16(23)17(8-4-1-5-9-17)24-15(22)12-13(20)10-6-2-3-7-11(10)19-14(12)21/h2-3,6-7H,1,4-5,8-9H2,(H2,18,23)(H2,19,20,21) |
| InChIKey | DLLGFWIOXGDHTM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate?
The IUPAC name of (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate (CID 91517821) is (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate.
What is the SMILES notation for (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate?
The canonical SMILES for (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate is NC(=O)C1(OC(=O)c2c(O)c3ccccc3[nH]c2=O)CCCCC1.
What is the InChIKey of (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate?
The InChIKey is DLLGFWIOXGDHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O5/c18-16(23)17(8-4-1-5-9-17)24-15(22)12-13(20)10-6-2-3-7-11(10)19-14(12)21/h2-3,6-7H,1,4-5,8-9H2,(H2,18,23)(H2,19,20,21).
What are the key properties of (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate?
(1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate has a molecular weight of 330.34 g/mol, XLogP of 1.58, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclohexyl) 4-hydroxy-2-oxo-1H-quinoline-3-carboxylate is sourced from PubChem (CID 91517821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).