C23H29ClN2O5 — CID 91517859
methyl 2-[(2S,3S,7aS,12bS)-9-chloro-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate (PubChem CID 91517859) has the molecular formula C23H29ClN2O5 and a molecular weight of 448.95 g/mol. Its IUPAC name is methyl 2-[(2S,3S,7aS,12bS)-9-chloro-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[(2S,3S,7aS,12bS)-9-chloro-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 91517859 |
| Molecular Formula | C23H29ClN2O5 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl 2-[(2S,3S,7aS,12bS)-9-chloro-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@@H]1CN2CC[C@@]3(O)C(=Nc4ccc(Cl)c(OC)c43)[C@@H]2C[C@@H]1C(=COC)C(=O)OC |
| InChI | InChI=1S/C23H29ClN2O5/c1-5-13-11-26-9-8-23(28)19-17(7-6-16(24)20(19)30-3)25-21(23)18(26)10-14(13)15(12-29-2)22(27)31-4/h6-7,12-14,18,28H,5,8-11H2,1-4H3/t13-,14+,18+,23+/m1/s1 |
| InChIKey | DZNWQYKQZWZQCI-XXEQDQQHSA-N |
| XLogP | 3.45 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|