C11H21N — CID 91518020
ethane;1,2,3,4,5-pentamethylpyrrole (PubChem CID 91518020) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is ethane;1,2,3,4,5-pentamethylpyrrole.
| Compound Name | ethane;1,2,3,4,5-pentamethylpyrrole |
|---|---|
| PubChem CID | 91518020 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | ethane;1,2,3,4,5-pentamethylpyrrole |
| SMILES | CC.Cc1c(C)c(C)n(C)c1C |
| InChI | InChI=1S/C9H15N.C2H6/c1-6-7(2)9(4)10(5)8(6)3;1-2/h1-5H3;1-2H3 |
| InChIKey | HWTQXWADHNBJJC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |