About 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol
4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 91518189) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 91518189 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1C=CC(n2ncnn2)=CC1 |
| InChI | InChI=1S/C7H8N4O/c12-7-3-1-6(2-4-7)11-9-5-8-10-11/h1-3,5,7,12H,4H2 |
| InChIKey | UEEYIBBKQZOEDI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol (CID 91518189) is 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol is OC1C=CC(n2ncnn2)=CC1.
What is the InChIKey of 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol?
The InChIKey is UEEYIBBKQZOEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c12-7-3-1-6(2-4-7)11-9-5-8-10-11/h1-3,5,7,12H,4H2.
What are the key properties of 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol?
4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol has a molecular weight of 164.17 g/mol, XLogP of -0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tetrazol-2-yl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 91518189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).