C26H32O5 — CID 91518241
(4R,10'R,13'S)-2-acetyl-2,6',10',13'-tetramethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene]-3',5-dione (PubChem CID 91518241) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is (4R,10'R,13'S)-2-acetyl-2,6',10',13'-tetramethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene]-3',5-dione.
| Compound Name | (4R,10'R,13'S)-2-acetyl-2,6',10',13'-tetramethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene]-3',5-dione |
|---|---|
| PubChem CID | 91518241 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (4R,10'R,13'S)-2-acetyl-2,6',10',13'-tetramethylspiro[1,3-dioxane-4,17'-7,8,12,14,15,16-hexahydro-4H-cyclopenta[a]phenanthrene]-3',5-dione |
| SMILES | CC(=O)C1(C)OCC(=O)[C@]2(CCC3C4CC(C)=C5CC(=O)C=C[C@]5(C)C4=CC[C@@]32C)O1 |
| InChI | InChI=1S/C26H32O5/c1-15-12-18-19(23(3)9-6-17(28)13-21(15)23)7-10-24(4)20(18)8-11-26(24)22(29)14-30-25(5,31-26)16(2)27/h6-7,9,18,20H,8,10-14H2,1-5H3/t18?,20?,23-,24+,25?,26+/m1/s1 |
| InChIKey | IOXLWRDOLYBROU-BDXHJROTSA-N |
| XLogP | 4.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|