C15H6F4O4 — CID 91518772
6,7-dihydroxy-2-[(2,3,5,6-tetrafluorophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 91518772) has the molecular formula C15H6F4O4 and a molecular weight of 326.20 g/mol. Its IUPAC name is 6,7-dihydroxy-2-[(2,3,5,6-tetrafluorophenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6,7-dihydroxy-2-[(2,3,5,6-tetrafluorophenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 91518772 |
| Molecular Formula | C15H6F4O4 |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 6,7-dihydroxy-2-[(2,3,5,6-tetrafluorophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2c(F)c(F)cc(F)c2F)Oc2c1ccc(O)c2O |
| InChI | InChI=1S/C15H6F4O4/c16-7-4-8(17)12(19)6(11(7)18)3-10-13(21)5-1-2-9(20)14(22)15(5)23-10/h1-4,20,22H |
| InChIKey | QKMSNGNQQNORMF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|