C16H22BrNO6 — CID 91518773
methyl 3-[1-bromo-1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxybenzoate (PubChem CID 91518773) has the molecular formula C16H22BrNO6 and a molecular weight of 404.26 g/mol. Its IUPAC name is methyl 3-[1-bromo-1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxybenzoate.
| Compound Name | methyl 3-[1-bromo-1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 91518773 |
| Molecular Formula | C16H22BrNO6 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | methyl 3-[1-bromo-1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxybenzoate |
| SMILES | COC(=O)c1cccc(OC(C)(NC(=O)OC(C)(C)C)C(O)Br)c1 |
| InChI | InChI=1S/C16H22BrNO6/c1-15(2,3)24-14(21)18-16(4,13(17)20)23-11-8-6-7-10(9-11)12(19)22-5/h6-9,13,20H,1-5H3,(H,18,21) |
| InChIKey | UADSNAKVVMLYCN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|