C38H39ClFN9O — CID 91518969
1,1-bis[2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-chlorophenyl)-3-(6-fluoro-3-pyridinyl)urea (PubChem CID 91518969) has the molecular formula C38H39ClFN9O and a molecular weight of 692.24 g/mol. Its IUPAC name is 1,1-bis[2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-chlorophenyl)-3-(6-fluoro-3-pyridinyl)urea.
| Compound Name | 1,1-bis[2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-chlorophenyl)-3-(6-fluoro-3-pyridinyl)urea |
|---|---|
| PubChem CID | 91518969 |
| Molecular Formula | C38H39ClFN9O |
| Molecular Weight | 692.24 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | 1,1-bis[2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-chlorophenyl)-3-(6-fluoro-3-pyridinyl)urea |
| SMILES | CN1CCC(N(C(=O)N(c2ccc(Cl)cc2)c2ccc(F)nc2)C2CCN(C)C(c3nc4ccccc4[nH]3)C2)CC1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C38H39ClFN9O/c1-46-19-17-26(21-33(46)36-42-29-7-3-4-8-30(29)43-36)49(27-18-20-47(2)34(22-27)37-44-31-9-5-6-10-32(31)45-37)38(50)48(25-13-11-24(39)12-14-25)28-15-16-35(40)41-23-28/h3-16,23,26-27,33-34H,17-22H2,1-2H3,(H,42,43)(H,44,45) |
| InChIKey | MTBQLAIQVCPNEP-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.24 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|