About (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine
(5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine (PubChem CID 91519185) has the molecular formula C25H24F2N2
and a molecular weight of 390.48 g/mol. Its IUPAC name is (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine.
Molecular Properties
| Compound Name | (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine |
| PubChem CID | 91519185 |
| Molecular Formula | C25H24F2N2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine |
| SMILES | Fc1ccc(N2CC3C(N(Cc4ccccc4)Cc4ccccc4)[C@H]3C2)cc1F |
| InChI | InChI=1S/C25H24F2N2/c26-23-12-11-20(13-24(23)27)28-16-21-22(17-28)25(21)29(14-18-7-3-1-4-8-18)15-19-9-5-2-6-10-19/h1-13,21-22,25H,14-17H2/t21-,22?,25?/m0/s1 |
| InChIKey | WVKNMOMOZYUHDB-LBXYRFPKSA-N |
| XLogP | 5.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
The IUPAC name of (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine (CID 91519185) is (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine.
What is the SMILES notation for (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
The canonical SMILES for (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine is Fc1ccc(N2CC3C(N(Cc4ccccc4)Cc4ccccc4)[C@H]3C2)cc1F.
What is the InChIKey of (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
The InChIKey is WVKNMOMOZYUHDB-LBXYRFPKSA-N. The full InChI is InChI=1S/C25H24F2N2/c26-23-12-11-20(13-24(23)27)28-16-21-22(17-28)25(21)29(14-18-7-3-1-4-8-18)15-19-9-5-2-6-10-19/h1-13,21-22,25H,14-17H2/t21-,22?,25?/m0/s1.
What are the key properties of (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
(5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine has a molecular weight of 390.48 g/mol, XLogP of 5.10, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N,N-dibenzyl-3-(3,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine is sourced from PubChem (CID 91519185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).