C17H33O5P — CID 91520019
5-(dimethylphosphorylmethyl)-2,2,4,4,7,7-hexamethyloctanedioic acid (PubChem CID 91520019) has the molecular formula C17H33O5P and a molecular weight of 348.42 g/mol. Its IUPAC name is 5-(dimethylphosphorylmethyl)-2,2,4,4,7,7-hexamethyloctanedioic acid.
| Compound Name | 5-(dimethylphosphorylmethyl)-2,2,4,4,7,7-hexamethyloctanedioic acid |
|---|---|
| PubChem CID | 91520019 |
| Molecular Formula | C17H33O5P |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 5-(dimethylphosphorylmethyl)-2,2,4,4,7,7-hexamethyloctanedioic acid |
| SMILES | CC(C)(CC(CP(C)(C)=O)C(C)(C)CC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H33O5P/c1-15(2,13(18)19)9-12(10-23(7,8)22)16(3,4)11-17(5,6)14(20)21/h12H,9-11H2,1-8H3,(H,18,19)(H,20,21) |
| InChIKey | VBGNVZTYKNMMNO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|