C25H34N4O3S — CID 91520132
(1S,2R,3R,4R)-2-[(4-acetyl-1,3-thiazol-2-yl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 91520132) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-[(4-acetyl-1,3-thiazol-2-yl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-[(4-acetyl-1,3-thiazol-2-yl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 91520132 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | (1S,2R,3R,4R)-2-[(4-acetyl-1,3-thiazol-2-yl)methyl]-3-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CC(=O)c1csc(C[C@@]2(C(N)=O)[C@H]3C=C[C@H](C34CC4)[C@@]2(CCCCN2CCCC2)C(N)=O)n1 |
| InChI | InChI=1S/C25H34N4O3S/c1-16(30)17-15-33-20(28-17)14-25(22(27)32)19-7-6-18(23(19)9-10-23)24(25,21(26)31)8-2-3-11-29-12-4-5-13-29/h6-7,15,18-19H,2-5,8-14H2,1H3,(H2,26,31)(H2,27,32)/t18-,19+,24+,25+/m1/s1 |
| InChIKey | BXHFFMXMXSTCSH-DRTRNHDVSA-N |
| XLogP | 2.69 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|