C11H14N+ — CID 91520198
8,8-dimethyl-8-azoniabicyclo[4.3.1]deca-1(10),2,4,6(10)-tetraene (PubChem CID 91520198) has the molecular formula C11H14N+ and a molecular weight of 160.24 g/mol. Its IUPAC name is 8,8-dimethyl-8-azoniabicyclo[4.3.1]deca-1(10),2,4,6(10)-tetraene.
| Compound Name | 8,8-dimethyl-8-azoniabicyclo[4.3.1]deca-1(10),2,4,6(10)-tetraene |
|---|---|
| PubChem CID | 91520198 |
| Molecular Formula | C11H14N+ |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 8,8-dimethyl-8-azoniabicyclo[4.3.1]deca-1(10),2,4,6(10)-tetraene |
| SMILES | C[N+]1(C)CC2=C=C(C=CC=C2)C1 |
| InChI | InChI=1S/C11H14N/c1-12(2)8-10-5-3-4-6-11(7-10)9-12/h3-6H,8-9H2,1-2H3/q+1 |
| InChIKey | XLXXDRZJAHBNHY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|