About 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene
4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 91520463) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene.
Analyze 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene (CID 91520463) is 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene is CC1=CC2C(C)C2C=N1.
What is the InChIKey of 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is UCARZAXNPAOHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-5-3-7-6(2)8(7)4-9-5/h3-4,6-8H,1-2H3.
What are the key properties of 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene?
4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 121.18 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-3-azabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 91520463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).