C19H16N4O2 — CID 91520628
2-[5-(3-oxo-2,5-dihydro-1H-imidazo[1,2-a]pyridin-2-yl)penta-2,4-dienylidene]imidazo[1,2-a]pyridin-3-one (PubChem CID 91520628) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[5-(3-oxo-2,5-dihydro-1H-imidazo[1,2-a]pyridin-2-yl)penta-2,4-dienylidene]imidazo[1,2-a]pyridin-3-one.
| Compound Name | 2-[5-(3-oxo-2,5-dihydro-1H-imidazo[1,2-a]pyridin-2-yl)penta-2,4-dienylidene]imidazo[1,2-a]pyridin-3-one |
|---|---|
| PubChem CID | 91520628 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[5-(3-oxo-2,5-dihydro-1H-imidazo[1,2-a]pyridin-2-yl)penta-2,4-dienylidene]imidazo[1,2-a]pyridin-3-one |
| SMILES | O=C1C(=CC=CC=CC2NC3=CC=CCN3C2=O)N=C2C=CC=CN12 |
| InChI | InChI=1S/C19H16N4O2/c24-18-14(20-16-10-4-6-12-22(16)18)8-2-1-3-9-15-19(25)23-13-7-5-11-17(23)21-15/h1-12,15,21H,13H2 |
| InChIKey | WPGCXWPBLGLYNU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|