About N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine
N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine (PubChem CID 91521102) has the molecular formula C15H32N4
and a molecular weight of 268.45 g/mol. Its IUPAC name is N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine |
| PubChem CID | 91521102 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine |
| SMILES | CC(C)=NCCCNCCCNCCCN=C(C)C |
| InChI | InChI=1S/C15H32N4/c1-14(2)18-12-6-10-16-8-5-9-17-11-7-13-19-15(3)4/h16-17H,5-13H2,1-4H3 |
| InChIKey | GDECLUZFRODOJW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine?
The IUPAC name of N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine (CID 91521102) is N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine.
What is the SMILES notation for N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine?
The canonical SMILES for N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine is CC(C)=NCCCNCCCNCCCN=C(C)C.
What is the InChIKey of N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine?
The InChIKey is GDECLUZFRODOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N4/c1-14(2)18-12-6-10-16-8-5-9-17-11-7-13-19-15(3)4/h16-17H,5-13H2,1-4H3.
What are the key properties of N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine?
N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine has a molecular weight of 268.45 g/mol, XLogP of 2.30, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis[3-(propan-2-ylideneamino)propyl]propane-1,3-diamine is sourced from PubChem (CID 91521102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).