C10H13NO — CID 91521797
4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine (PubChem CID 91521797) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine.
| Compound Name | 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 91521797 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine |
| SMILES | CCc1cnc(C)c2c1CCO2 |
| InChI | InChI=1S/C10H13NO/c1-3-8-6-11-7(2)10-9(8)4-5-12-10/h6H,3-5H2,1-2H3 |
| InChIKey | MDDTVTHTKSNJEF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |