About 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine
4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine (PubChem CID 91521797) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine.
Molecular Properties
| Compound Name | 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine |
| PubChem CID | 91521797 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine |
| SMILES | CCc1cnc(C)c2c1CCO2 |
| InChI | InChI=1S/C10H13NO/c1-3-8-6-11-7(2)10-9(8)4-5-12-10/h6H,3-5H2,1-2H3 |
| InChIKey | MDDTVTHTKSNJEF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine?
The IUPAC name of 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine (CID 91521797) is 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine.
What is the SMILES notation for 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine?
The canonical SMILES for 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine is CCc1cnc(C)c2c1CCO2.
What is the InChIKey of 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine?
The InChIKey is MDDTVTHTKSNJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-3-8-6-11-7(2)10-9(8)4-5-12-10/h6H,3-5H2,1-2H3.
What are the key properties of 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine?
4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine has a molecular weight of 163.22 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-7-methyl-2,3-dihydrofuro[2,3-c]pyridine is sourced from PubChem (CID 91521797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).