C15H24N4O5S — CID 91522160
[(1S,2S,4R)-4-[6-(cyclopentylamino)pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]-methylsulfamic acid (PubChem CID 91522160) has the molecular formula C15H24N4O5S and a molecular weight of 372.45 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[6-(cyclopentylamino)pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]-methylsulfamic acid.
| Compound Name | [(1S,2S,4R)-4-[6-(cyclopentylamino)pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]-methylsulfamic acid |
|---|---|
| PubChem CID | 91522160 |
| Molecular Formula | C15H24N4O5S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [(1S,2S,4R)-4-[6-(cyclopentylamino)pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]-methylsulfamic acid |
| SMILES | CN([C@H]1C[C@@H](Oc2cc(NC3CCCC3)ncn2)C[C@@H]1O)S(=O)(=O)O |
| InChI | InChI=1S/C15H24N4O5S/c1-19(25(21,22)23)12-6-11(7-13(12)20)24-15-8-14(16-9-17-15)18-10-4-2-3-5-10/h8-13,20H,2-7H2,1H3,(H,16,17,18)(H,21,22,23)/t11-,12+,13+/m1/s1 |
| InChIKey | LJMSCACJSHWYNN-AGIUHOORSA-N |
| XLogP | 0.84 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|