C29H40N6O6 — CID 91522342
4-N-cyclohexyl-2-N,2-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 91522342) has the molecular formula C29H40N6O6 and a molecular weight of 568.68 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N,2-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-cyclohexyl-2-N,2-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 91522342 |
| Molecular Formula | C29H40N6O6 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 4-N-cyclohexyl-2-N,2-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1cc(CN(Cc2cc(OC)c(OC)c(OC)c2)c2nc(N)nc(NC3CCCCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C29H40N6O6/c1-36-21-12-18(13-22(37-2)25(21)40-5)16-35(17-19-14-23(38-3)26(41-6)24(15-19)39-4)29-33-27(30)32-28(34-29)31-20-10-8-7-9-11-20/h12-15,20H,7-11,16-17H2,1-6H3,(H3,30,31,32,33,34) |
| InChIKey | OZZIHHSCCKEXIN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |