About 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide
6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide (PubChem CID 91522563) has the molecular formula C6H6N2OS
and a molecular weight of 154.19 g/mol. Its IUPAC name is 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide.
Molecular Properties
| Compound Name | 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide |
| PubChem CID | 91522563 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide |
| SMILES | O=S1CCc2ncncc21 |
| InChI | InChI=1S/C6H6N2OS/c9-10-2-1-5-6(10)3-7-4-8-5/h3-4H,1-2H2 |
| InChIKey | OFLNFKHGFANRCZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
The IUPAC name of 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide (CID 91522563) is 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide.
What is the SMILES notation for 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
The canonical SMILES for 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide is O=S1CCc2ncncc21.
What is the InChIKey of 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
The InChIKey is OFLNFKHGFANRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2OS/c9-10-2-1-5-6(10)3-7-4-8-5/h3-4H,1-2H2.
What are the key properties of 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide has a molecular weight of 154.19 g/mol, XLogP of 0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide is sourced from PubChem (CID 91522563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).