About 2-methylimidazolidine-4,5-dicarbonitrile
2-methylimidazolidine-4,5-dicarbonitrile (PubChem CID 91522645) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 2-methylimidazolidine-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-methylimidazolidine-4,5-dicarbonitrile |
| PubChem CID | 91522645 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 2-methylimidazolidine-4,5-dicarbonitrile |
| SMILES | CC1NC(C#N)C(C#N)N1 |
| InChI | InChI=1S/C6H8N4/c1-4-9-5(2-7)6(3-8)10-4/h4-6,9-10H,1H3 |
| InChIKey | OJKAHDRUXWFJNM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylimidazolidine-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazolidine-4,5-dicarbonitrile?
The IUPAC name of 2-methylimidazolidine-4,5-dicarbonitrile (CID 91522645) is 2-methylimidazolidine-4,5-dicarbonitrile.
What is the SMILES notation for 2-methylimidazolidine-4,5-dicarbonitrile?
The canonical SMILES for 2-methylimidazolidine-4,5-dicarbonitrile is CC1NC(C#N)C(C#N)N1.
What is the InChIKey of 2-methylimidazolidine-4,5-dicarbonitrile?
The InChIKey is OJKAHDRUXWFJNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c1-4-9-5(2-7)6(3-8)10-4/h4-6,9-10H,1H3.
What are the key properties of 2-methylimidazolidine-4,5-dicarbonitrile?
2-methylimidazolidine-4,5-dicarbonitrile has a molecular weight of 136.16 g/mol, XLogP of -0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazolidine-4,5-dicarbonitrile is sourced from PubChem (CID 91522645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).