About 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid
5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid (PubChem CID 91523242) has the molecular formula C13H13N5O4S
and a molecular weight of 335.35 g/mol. Its IUPAC name is 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| PubChem CID | 91523242 |
| Molecular Formula | C13H13N5O4S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| SMILES | CC1=Nc2nnnn2C(c2ccc(S(C)(=O)=O)cc2)C1C(=O)O |
| InChI | InChI=1S/C13H13N5O4S/c1-7-10(12(19)20)11(18-13(14-7)15-16-17-18)8-3-5-9(6-4-8)23(2,21)22/h3-6,10-11H,1-2H3,(H,19,20) |
| InChIKey | KQYIATXHUUSAHG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid?
The IUPAC name of 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid (CID 91523242) is 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid.
What is the SMILES notation for 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid?
The canonical SMILES for 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid is CC1=Nc2nnnn2C(c2ccc(S(C)(=O)=O)cc2)C1C(=O)O.
What is the InChIKey of 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid?
The InChIKey is KQYIATXHUUSAHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O4S/c1-7-10(12(19)20)11(18-13(14-7)15-16-17-18)8-3-5-9(6-4-8)23(2,21)22/h3-6,10-11H,1-2H3,(H,19,20).
What are the key properties of 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid?
5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid has a molecular weight of 335.35 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-7-(4-methylsulfonylphenyl)-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 91523242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).