C27H33N3O2 — CID 91523701
[4-[[butyl-[5-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]methyl]-2-ethylphenyl] acetate (PubChem CID 91523701) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is [4-[[butyl-[5-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]methyl]-2-ethylphenyl] acetate.
| Compound Name | [4-[[butyl-[5-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]methyl]-2-ethylphenyl] acetate |
|---|---|
| PubChem CID | 91523701 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | [4-[[butyl-[5-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]methyl]-2-ethylphenyl] acetate |
| SMILES | CCCCN(Cc1ccc(OC(C)=O)c(CC)c1)c1ncnc(-c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C27H33N3O2/c1-6-8-15-30(17-22-11-14-25(32-21(5)31)23(7-2)16-22)27-20(4)26(28-18-29-27)24-12-9-19(3)10-13-24/h9-14,16,18H,6-8,15,17H2,1-5H3 |
| InChIKey | YLQDCWYTBBEQEF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|