About N-[(Z)-1,2-difluoroethenyl]pentan-1-imine
N-[(Z)-1,2-difluoroethenyl]pentan-1-imine (PubChem CID 91524228) has the molecular formula C7H11F2N
and a molecular weight of 147.17 g/mol. Its IUPAC name is N-[(Z)-1,2-difluoroethenyl]pentan-1-imine.
Molecular Properties
| Compound Name | N-[(Z)-1,2-difluoroethenyl]pentan-1-imine |
| PubChem CID | 91524228 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | N-[(Z)-1,2-difluoroethenyl]pentan-1-imine |
| SMILES | CCCCC=N/C(F)=C/F |
| InChI | InChI=1S/C7H11F2N/c1-2-3-4-5-10-7(9)6-8/h5-6H,2-4H2,1H3/b7-6+,10-5? |
| InChIKey | TXVUOWYDXMGKOF-DVIQWAPXSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1,2-difluoroethenyl]pentan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1,2-difluoroethenyl]pentan-1-imine?
The IUPAC name of N-[(Z)-1,2-difluoroethenyl]pentan-1-imine (CID 91524228) is N-[(Z)-1,2-difluoroethenyl]pentan-1-imine.
What is the SMILES notation for N-[(Z)-1,2-difluoroethenyl]pentan-1-imine?
The canonical SMILES for N-[(Z)-1,2-difluoroethenyl]pentan-1-imine is CCCCC=N/C(F)=C/F.
What is the InChIKey of N-[(Z)-1,2-difluoroethenyl]pentan-1-imine?
The InChIKey is TXVUOWYDXMGKOF-DVIQWAPXSA-N. The full InChI is InChI=1S/C7H11F2N/c1-2-3-4-5-10-7(9)6-8/h5-6H,2-4H2,1H3/b7-6+,10-5?.
What are the key properties of N-[(Z)-1,2-difluoroethenyl]pentan-1-imine?
N-[(Z)-1,2-difluoroethenyl]pentan-1-imine has a molecular weight of 147.17 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1,2-difluoroethenyl]pentan-1-imine is sourced from PubChem (CID 91524228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).