C19H10N4O2 — CID 91524930
quinoxalino[2,3-f][1,10]phenanthroline-7-carboxylic acid (PubChem CID 91524930) has the molecular formula C19H10N4O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is quinoxalino[2,3-f][1,10]phenanthroline-7-carboxylic acid.
| Compound Name | quinoxalino[2,3-f][1,10]phenanthroline-7-carboxylic acid |
|---|---|
| PubChem CID | 91524930 |
| Molecular Formula | C19H10N4O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | quinoxalino[2,3-f][1,10]phenanthroline-7-carboxylic acid |
| SMILES | O=C(O)c1cnc2c(c1)c1nc3ccccc3nc1c1cccnc12 |
| InChI | InChI=1S/C19H10N4O2/c24-19(25)10-8-12-16(21-9-10)15-11(4-3-7-20-15)17-18(12)23-14-6-2-1-5-13(14)22-17/h1-9H,(H,24,25) |
| InChIKey | MBOAMMDOFDMNDK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|