C10H14N2O — CID 91524988
N-methyl-2,6,7,7a-tetrahydroindole-1-carboxamide (PubChem CID 91524988) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is N-methyl-2,6,7,7a-tetrahydroindole-1-carboxamide.
| Compound Name | N-methyl-2,6,7,7a-tetrahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 91524988 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N-methyl-2,6,7,7a-tetrahydroindole-1-carboxamide |
| SMILES | CNC(=O)N1CC=C2C=CCCC21 |
| InChI | InChI=1S/C10H14N2O/c1-11-10(13)12-7-6-8-4-2-3-5-9(8)12/h2,4,6,9H,3,5,7H2,1H3,(H,11,13) |
| InChIKey | DVPOUBQKTNISHI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |