About (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate
(4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate (PubChem CID 91525493) has the molecular formula C10H16N2O4
and a molecular weight of 228.25 g/mol. Its IUPAC name is (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate |
| PubChem CID | 91525493 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)OC1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C10H16N2O4/c1-9(2,3)5-6(13)16-10(4)7(14)11-8(15)12-10/h5H2,1-4H3,(H2,11,12,14,15) |
| InChIKey | SKEFNPUSXTYBLY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate?
The IUPAC name of (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate (CID 91525493) is (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate.
What is the SMILES notation for (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate?
The canonical SMILES for (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate is CC(C)(C)CC(=O)OC1(C)NC(=O)NC1=O.
What is the InChIKey of (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate?
The InChIKey is SKEFNPUSXTYBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4/c1-9(2,3)5-6(13)16-10(4)7(14)11-8(15)12-10/h5H2,1-4H3,(H2,11,12,14,15).
What are the key properties of (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate?
(4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate has a molecular weight of 228.25 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2,5-dioxoimidazolidin-4-yl) 3,3-dimethylbutanoate is sourced from PubChem (CID 91525493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).