C36H39FN8O3 — CID 91525505
[5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(2,3,4-trimethylphenyl)phenyl]methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate (PubChem CID 91525505) has the molecular formula C36H39FN8O3 and a molecular weight of 650.76 g/mol. Its IUPAC name is [5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(2,3,4-trimethylphenyl)phenyl]methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate.
| Compound Name | [5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(2,3,4-trimethylphenyl)phenyl]methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 91525505 |
| Molecular Formula | C36H39FN8O3 |
| Molecular Weight | 650.76 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | [5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(2,3,4-trimethylphenyl)phenyl]methyl N-[2-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]pyrimidin-4-yl]carbamate |
| SMILES | Cc1nc(-c2ccc(-c3ccc(C)c(C)c3C)c(COC(=O)Nc3ccnc(Nc4ccc(N5CCN(C)C(C)C5)c(F)c4)n3)c2)no1 |
| InChI | InChI=1S/C36H39FN8O3/c1-21-7-10-29(24(4)23(21)3)30-11-8-26(34-39-25(5)48-43-34)17-27(30)20-47-36(46)42-33-13-14-38-35(41-33)40-28-9-12-32(31(37)18-28)45-16-15-44(6)22(2)19-45/h7-14,17-18,22H,15-16,19-20H2,1-6H3,(H2,38,40,41,42,46) |
| InChIKey | XLTJBKDCOMDBBZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|