C23H31N3O3S — CID 9152569
3,4-dimethyl-N-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]benzenesulfonamide (PubChem CID 9152569) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9152569 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3,4-dimethyl-N-[4-[4-(2-methylphenyl)piperazin-1-yl]-4-oxobutyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC(=O)N2CCN(c3ccccc3C)CC2)cc1C |
| InChI | InChI=1S/C23H31N3O3S/c1-18-10-11-21(17-20(18)3)30(28,29)24-12-6-9-23(27)26-15-13-25(14-16-26)22-8-5-4-7-19(22)2/h4-5,7-8,10-11,17,24H,6,9,12-16H2,1-3H3 |
| InChIKey | JTOIQQAENBMXSE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|